CAS 1325700-11-5 appears in our catalog under these names: Firocoxib-d4, Firocoxib-d4, >95% (HPLC), Firocoxib–d4. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
5,5-dimethyl-4-(4-methylsulfonylphenyl)-3-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]furan-2-one (CAS 1325700-11-5) is a chemical compound with the molecular formula C17H20O5S and a molecular weight of 340.4 g/mol. IUPAC name: 5,5-dimethyl-4-(4-methylsulfonylphenyl)-3-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]furan-2-one. InChIKey: FULAPETWGIGNMT-CQOLUAMGSA-N.
| Molecular formula | C17H20O5S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 5,5-dimethyl-4-(4-methylsulfonylphenyl)-3-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]furan-2-one |
| InChIKey | FULAPETWGIGNMT-CQOLUAMGSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])COC2=C(C(OC2=O)(C)C)C3=CC=C(C=C3)S(=O)(=O)C)[2H] |
Computed by PubChem (NCBI)