CAS 13260-91-8 is the registry number for H-Ala-Tyr-OEt·HCl. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
Ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 13260-91-8) is a chemical compound with the molecular formula C14H21ClN2O4 and a molecular weight of 316.78 g/mol. IUPAC name: ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: IRILGEJGARIVDP-CSDGMEMJSA-N.
| Molecular formula | C14H21ClN2O4 |
|---|---|
| Molecular weight | 316.78 g/mol |
| IUPAC name | ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | IRILGEJGARIVDP-CSDGMEMJSA-N |
| SMILES | CCOC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)[C@H](C)N.Cl |
Computed by PubChem (NCBI)