CAS 132679-61-9 appears in our catalog under these names: N-(2,4-Dinitro-5-fluorophenyl)-L-valinamide, (S)–2–((5–Fluoro–2,4–dinitrophenyl)amino)–3–methylbutanamide, N-alpha-(2,4-Dinitro-5-fluorophenyl)-L-valine amide, (5-F-DNP)-Val-NH2 97%, N(ALPHA)-(2,4-DINITRO-5-FLUOROPHENYL)- &. Offered by: TRC, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 2,5g, 250mg, 1g, 25g, 5g, 1000mg, 500mg, 2000mg.
(2S)-2-(5-fluoro-2,4-dinitroanilino)-3-methylbutanamide (CAS 132679-61-9) is a chemical compound with the molecular formula C11H13FN4O5 and a molecular weight of 300.24 g/mol. IUPAC name: (2S)-2-(5-fluoro-2,4-dinitroanilino)-3-methylbutanamide. InChIKey: ZTFFRKNPAXXEBL-JTQLQIEISA-N.
| Molecular formula | C11H13FN4O5 |
|---|---|
| Molecular weight | 300.24 g/mol |
| IUPAC name | (2S)-2-(5-fluoro-2,4-dinitroanilino)-3-methylbutanamide |
| InChIKey | ZTFFRKNPAXXEBL-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])F |
Computed by PubChem (NCBI)