CAS 1326809-24-8 is the registry number for 4-(4-Nitrobenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-nitrobenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid (CAS 1326809-24-8) is a chemical compound with the molecular formula C16H18N2O6 and a molecular weight of 334.32 g/mol. IUPAC name: 4-(4-nitrobenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid. InChIKey: JYNRKBPNWZASMT-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O6 |
|---|---|
| Molecular weight | 334.32 g/mol |
| IUPAC name | 4-(4-nitrobenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid |
| InChIKey | JYNRKBPNWZASMT-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)N(C(CO2)C(=O)O)C(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)