CAS 1326815-58-0 is the registry number for 2-(2-((5-Chloro-1,2,4-thiadiazol-3-yl)thio)ethyl)isoindoline-1,3-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-[(5-chloro-1,2,4-thiadiazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione (CAS 1326815-58-0) is a chemical compound with the molecular formula C12H8ClN3O2S2 and a molecular weight of 325.8 g/mol. IUPAC name: 2-[2-[(5-chloro-1,2,4-thiadiazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione. InChIKey: BAOIXEXWRLRBPW-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O2S2 |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 2-[2-[(5-chloro-1,2,4-thiadiazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione |
| InChIKey | BAOIXEXWRLRBPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCSC3=NSC(=N3)Cl |
Computed by PubChem (NCBI)