CAS 132682-98-5 appears in our catalog under these names: GLUFOSFAMIDE, 98%, Glufosfamide, Glufosfamide/ 99.75% (existing batch purity), Glufosfamide, ≥96%, ≥96%, Glufosfamide, 98.0%. Offered by: AmBeed, TRC, TargetMol, Biosynth, Chemat. Available pack sizes: 100mg, 50mg, 1mg, 5mg, 10mg, 25mg, 10 mg, 100 mg.
(2S,3R,4S,5S,6R)-2-bis(2-chloroethylamino)phosphoryloxy-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 132682-98-5) is a chemical compound with the molecular formula C10H21Cl2N2O7P and a molecular weight of 383.16 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-bis(2-chloroethylamino)phosphoryloxy-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: PSVUJBVBCOISSP-SPFKKGSWSA-N.
| Molecular formula | C10H21Cl2N2O7P |
|---|---|
| Molecular weight | 383.16 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-bis(2-chloroethylamino)phosphoryloxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | PSVUJBVBCOISSP-SPFKKGSWSA-N |
| SMILES | C(CCl)NP(=O)(NCCCl)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)