CAS 132685-02-0 appears in our catalog under these names: 1,1'-Ethylidenebis(L-tryptophan), >95% (HPLC), 1,1’-Ethylidenebis(L-tryptophan), >95% (HPLC), Tryptophan EP Impurity A, 1,1'–Ethylidene–bis–(L–tryptophan), 1,1'-Ethylidene-bis-(L-tryptophan). Offered by: TRC, Mikromol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 50mg, 25mg, 1mg, 5mg, 2EA, 50 mg.
(2S)-2-amino-3-[1-[1-[3-[(2S)-2-amino-2-carboxyethyl]indol-1-yl]ethyl]indol-3-yl]propanoic acid (CAS 132685-02-0) is a chemical compound with the molecular formula C24H26N4O4 and a molecular weight of 434.5 g/mol. IUPAC name: (2S)-2-amino-3-[1-[1-[3-[(2S)-2-amino-2-carboxyethyl]indol-1-yl]ethyl]indol-3-yl]propanoic acid. InChIKey: DETVQFQGSVEQBH-PMACEKPBSA-N.
| Molecular formula | C24H26N4O4 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | (2S)-2-amino-3-[1-[1-[3-[(2S)-2-amino-2-carboxyethyl]indol-1-yl]ethyl]indol-3-yl]propanoic acid |
| InChIKey | DETVQFQGSVEQBH-PMACEKPBSA-N |
| SMILES | CC(N1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)N)N3C=C(C4=CC=CC=C43)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)