CAS 13270-56-9 appears in our catalog under these names: (S)-6-Methylnicotine, >95% (HPLC), (S)-6-Methylnicotine (1mg/mL in Methanol), (S)-6-Methylnicotine, (S)-6-Methylnicotine, 98%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 10mg, 2,5mg, 25mg, 1x1ml, 5mg, 100mg, 250mg, 1g.
2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 13270-56-9) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: 2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: SWNIAVIKMKSDBJ-NSHDSACASA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | 2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChIKey | SWNIAVIKMKSDBJ-NSHDSACASA-N |
| SMILES | CC1=NC=C(C=C1)[C@@H]2CCCN2C |
Computed by PubChem (NCBI)