CAS 13270-97-8 is the registry number for 3,5–DIPHENYLOCTAMETHYLTETRASILOXANE. Offered by: GLPBio. Available pack sizes: 25g.
Trimethyl-[methyl-(methyl-phenyl-trimethylsilyloxysilyl)oxy-phenylsilyl]oxysilane (CAS 13270-97-8) is a chemical compound with the molecular formula C20H34O3Si4 and a molecular weight of 434.8 g/mol. IUPAC name: trimethyl-[methyl-(methyl-phenyl-trimethylsilyloxysilyl)oxy-phenylsilyl]oxysilane. InChIKey: MRUHXDZUINGBFB-UHFFFAOYSA-N.
| Molecular formula | C20H34O3Si4 |
|---|---|
| Molecular weight | 434.8 g/mol |
| IUPAC name | trimethyl-[methyl-(methyl-phenyl-trimethylsilyloxysilyl)oxy-phenylsilyl]oxysilane |
| InChIKey | MRUHXDZUINGBFB-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C1=CC=CC=C1)O[Si](C)(C2=CC=CC=C2)O[Si](C)(C)C |
Computed by PubChem (NCBI)