Products 1327080-54-5
CAS 1327080-54-5 is the registry number for 3-(3-Phenoxybenzyl)amino-β-carboline. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(3-phenoxyphenyl)methyl]-9H-pyrido[3,4-b]indol-3-amine (CAS 1327080-54-5) is a chemical compound with the molecular formula C24H19N3O and a molecular weight of 365.4 g/mol. IUPAC name: N-[(3-phenoxyphenyl)methyl]-9H-pyrido[3,4-b]indol-3-amine. InChIKey: DMCDUELFWCRWHE-UHFFFAOYSA-N.
| Molecular formula | C24H19N3O |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | N-[(3-phenoxyphenyl)methyl]-9H-pyrido[3,4-b]indol-3-amine |
| InChIKey | DMCDUELFWCRWHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)CNC3=NC=C4C(=C3)C5=CC=CC=C5N4 |
Computed by PubChem (NCBI)