Products 1327178-82-4
CAS 1327178-82-4 is the registry number for (N'-tert-Butoxycarbonyl-hydrazino)-imino-acetic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl (2Z)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]acetate (CAS 1327178-82-4) is a chemical compound with the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl (2Z)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]acetate. InChIKey: KVYDKLDNFUYBAK-UHFFFAOYSA-N.
| Molecular formula | C9H17N3O4 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl (2Z)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]acetate |
| InChIKey | KVYDKLDNFUYBAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)/C(=N/NC(=O)OC(C)(C)C)/N |
Computed by PubChem (NCBI)