CAS 13276-52-3 appears in our catalog under these names: 2,6-Dichloro-9-(β-D-ribofuranosyl)purine, min. 95 %, 1 g, 2,6-Dichloropurine riboside, 97%, 2,6-Dichloropurine-9-Beta-D-riboside, >95% (HPLC), 2,6-Dichloropurine-9-β-D-riboside, 2,6–Dichloropurine–9–β–D–riboside. Offered by: Roth, Combi-blocks, TRC, TargetMol, GLPBio. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 500mg, 25mg, 50mg.
(2R,3R,4S,5R)-2-(2,6-dichloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 13276-52-3) is a chemical compound with the molecular formula C10H10Cl2N4O4 and a molecular weight of 321.11 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(2,6-dichloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: HJXWZGVMHDPCRS-UUOKFMHZSA-N.
| Molecular formula | C10H10Cl2N4O4 |
|---|---|
| Molecular weight | 321.11 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(2,6-dichloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | HJXWZGVMHDPCRS-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)