CAS 132799-10-1 is the registry number for (2R,3S,4R,5S,6S)-2-(Ethylthio)-6-methyltetrahydro-2H-pyran-3,4,5-triol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4R,5S,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol (CAS 132799-10-1) is a chemical compound with the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. IUPAC name: (2R,3S,4R,5S,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol. InChIKey: FFRRGRSSCFQGAP-FMGWEMOISA-N.
| Molecular formula | C8H16O4S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | (2R,3S,4R,5S,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol |
| InChIKey | FFRRGRSSCFQGAP-FMGWEMOISA-N |
| SMILES | CCS[C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)C)O)O)O |
Computed by PubChem (NCBI)