CAS 132813-13-9 is the registry number for Blonanserin Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-phenyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine (CAS 132813-13-9) is a chemical compound with the molecular formula C17H18ClN and a molecular weight of 271.8 g/mol. IUPAC name: 2-chloro-4-phenyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine. InChIKey: CRIVIMKHXVCZDM-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN |
|---|---|
| Molecular weight | 271.8 g/mol |
| IUPAC name | 2-chloro-4-phenyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
| InChIKey | CRIVIMKHXVCZDM-UHFFFAOYSA-N |
| SMILES | C1CCCC2=C(CC1)C(=CC(=N2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)