Products 13286-32-3

CAS 13286-32-3 is the registry number for Isoprobenphos. Offered by: Chemat Brand, Dr. Ehrenstorfer. Available pack sizes: on request, 50mg.

Structural formula: {0} (CAS {1})

Diethoxyphosphorylsulfanylmethylbenzene (CAS 13286-32-3) is a chemical compound with the molecular formula C11H17O3PS and a molecular weight of 260.29 g/mol. IUPAC name: diethoxyphosphorylsulfanylmethylbenzene. InChIKey: XFMJUIKWKVJNDY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17O3PS
Molecular weight260.29 g/mol
IUPAC namediethoxyphosphorylsulfanylmethylbenzene
InChIKeyXFMJUIKWKVJNDY-UHFFFAOYSA-N
SMILESCCOP(=O)(OCC)SCC1=CC=CC=C1

Computed by PubChem (NCBI)