CAS 13286-59-4 is the registry number for Trans-1-amino-2,3-dihydro-1H-inden-2-ol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-ol (CAS 13286-59-4) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (1R,2R)-1-amino-2,3-dihydro-1H-inden-2-ol. InChIKey: LOPKSXMQWBYUOI-RKDXNWHRSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (1R,2R)-1-amino-2,3-dihydro-1H-inden-2-ol |
| InChIKey | LOPKSXMQWBYUOI-RKDXNWHRSA-N |
| SMILES | C1[C@H]([C@@H](C2=CC=CC=C21)N)O |
Computed by PubChem (NCBI)