Products 1328882-35-4

CAS 1328882-35-4 is the registry number for 4-Formylbenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-formylbenzoyl fluoride (CAS 1328882-35-4) is a chemical compound with the molecular formula C8H5FO2 and a molecular weight of 152.12 g/mol. IUPAC name: 4-formylbenzoyl fluoride. InChIKey: QFIWHCBJMCWPTL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5FO2
Molecular weight152.12 g/mol
IUPAC name4-formylbenzoyl fluoride
InChIKeyQFIWHCBJMCWPTL-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C=O)C(=O)F

Computed by PubChem (NCBI)