CAS 1328894-26-3 is the registry number for 1-{[4-bromo-3-(trifluoromethyl)benzene]sulfonyl}pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1-[4-bromo-3-(trifluoromethyl)phenyl]sulfonylpyrrolidine (CAS 1328894-26-3) is a chemical compound with the molecular formula C11H11BrF3NO2S and a molecular weight of 358.18 g/mol. IUPAC name: 1-[4-bromo-3-(trifluoromethyl)phenyl]sulfonylpyrrolidine. InChIKey: IZZMXZYFRAASMF-UHFFFAOYSA-N.
| Molecular formula | C11H11BrF3NO2S |
|---|---|
| Molecular weight | 358.18 g/mol |
| IUPAC name | 1-[4-bromo-3-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
| InChIKey | IZZMXZYFRAASMF-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)