CAS 132898-96-5 appears in our catalog under these names: 5-(Chlorosulfonyl) Isatin, 2,3-Dioxoindoline-5-sulfonyl chloride, 95%, 2,3-Dioxo-1H-indole-5-sulfonyl chloride, 95%. Offered by: TRC, Biosynth, Fluorochem, Combi-blocks. Available pack sizes: 100mg, 1g, 2g, 5g, 250mg.
2,3-dioxo-1H-indole-5-sulfonyl chloride (CAS 132898-96-5) is a chemical compound with the molecular formula C8H4ClNO4S and a molecular weight of 245.64 g/mol. IUPAC name: 2,3-dioxo-1H-indole-5-sulfonyl chloride. InChIKey: JUJRKHHCIXKFQG-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO4S |
|---|---|
| Molecular weight | 245.64 g/mol |
| IUPAC name | 2,3-dioxo-1H-indole-5-sulfonyl chloride |
| InChIKey | JUJRKHHCIXKFQG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)