CAS 132898-97-6 is the registry number for 5-(2-Thienyl)-1H-indole-2,3-dione, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-thiophen-2-yl-1H-indole-2,3-dione (CAS 132898-97-6) is a chemical compound with the molecular formula C12H7NO2S and a molecular weight of 229.26 g/mol. IUPAC name: 5-thiophen-2-yl-1H-indole-2,3-dione. InChIKey: YOFGZEWPLABWQJ-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 5-thiophen-2-yl-1H-indole-2,3-dione |
| InChIKey | YOFGZEWPLABWQJ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC3=C(C=C2)NC(=O)C3=O |
Computed by PubChem (NCBI)