CAS 13291-46-8 appears in our catalog under these names: 2,5-Dihydroxyphenyl(diphenyl)phosphine oxide, 97%, 2,5-Dihydroxyphenyl(diphenyl)phosphine Oxide, 98%, 2,5–Dihydroxyphenyl(diphenyl)phosphine Oxide, 2,5-Dihydroxyphenyl(diphenyl)phosphine Oxide, >97.0%(GC), 2,5-Dihydroxyphenyl(Diphenyl)Phosphine Oxide, 99%(LC-MS),RG, 99%(LC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g, 100g, 500g.
2-diphenylphosphorylbenzene-1,4-diol (CAS 13291-46-8) is a chemical compound with the molecular formula C18H15O3P and a molecular weight of 310.3 g/mol. IUPAC name: 2-diphenylphosphorylbenzene-1,4-diol. InChIKey: LLOXZCFOAUCDAE-UHFFFAOYSA-N.
| Molecular formula | C18H15O3P |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 2-diphenylphosphorylbenzene-1,4-diol |
| InChIKey | LLOXZCFOAUCDAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=C(C=CC(=C3)O)O |
Computed by PubChem (NCBI)