CAS 132944-55-9 is the registry number for 2,3-diaza-1-ethylthio-4-phenylbuta-1,3-dienylamine, iodide. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl N'-[(E)-benzylideneamino]carbamimidothioate;hydroiodide (CAS 132944-55-9) is a chemical compound with the molecular formula C10H14IN3S and a molecular weight of 335.21 g/mol. IUPAC name: ethyl N'-[(E)-benzylideneamino]carbamimidothioate;hydroiodide. InChIKey: CPGSXOZEVRCBJI-MXZHIVQLSA-N.
| Molecular formula | C10H14IN3S |
|---|---|
| Molecular weight | 335.21 g/mol |
| IUPAC name | ethyl N'-[(E)-benzylideneamino]carbamimidothioate;hydroiodide |
| InChIKey | CPGSXOZEVRCBJI-MXZHIVQLSA-N |
| SMILES | CCS/C(=N/N=C/C1=CC=CC=C1)/N.I |
Computed by PubChem (NCBI)