CAS 1329471-16-0 is the registry number for 4–Bromo–5–tert–butyl–3–(trifluoromethyl)–1H–Pyrazole. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
4-bromo-3-tert-butyl-5-(trifluoromethyl)-1H-pyrazole (CAS 1329471-16-0) is a chemical compound with the molecular formula C8H10BrF3N2 and a molecular weight of 271.08 g/mol. IUPAC name: 4-bromo-3-tert-butyl-5-(trifluoromethyl)-1H-pyrazole. InChIKey: AJSUQONSUOXPKI-UHFFFAOYSA-N.
| Molecular formula | C8H10BrF3N2 |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | 4-bromo-3-tert-butyl-5-(trifluoromethyl)-1H-pyrazole |
| InChIKey | AJSUQONSUOXPKI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NNC(=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)