CAS 1329474-59-0 is the registry number for Serotonin Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl 3-(2-acetamidoethyl)-5-[(2-methylpropan-2-yl)oxycarbonyloxy]indole-1-carboxylate (CAS 1329474-59-0) is a chemical compound with the molecular formula C22H30N2O6 and a molecular weight of 418.5 g/mol. IUPAC name: tert-butyl 3-(2-acetamidoethyl)-5-[(2-methylpropan-2-yl)oxycarbonyloxy]indole-1-carboxylate. InChIKey: YVQMPLGGLYQKHM-UHFFFAOYSA-N.
| Molecular formula | C22H30N2O6 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | tert-butyl 3-(2-acetamidoethyl)-5-[(2-methylpropan-2-yl)oxycarbonyloxy]indole-1-carboxylate |
| InChIKey | YVQMPLGGLYQKHM-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCC1=CN(C2=C1C=C(C=C2)OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)