CAS 1329488-72-3 is the registry number for 1,3-Dimethylthiourea-d6. Offered by: TRC. Available pack sizes: 100mg.
1,3-bis(trideuteriomethyl)thiourea (CAS 1329488-72-3) is a chemical compound with the molecular formula C3H8N2S and a molecular weight of 110.21 g/mol. IUPAC name: 1,3-bis(trideuteriomethyl)thiourea. InChIKey: VLCDUOXHFNUCKK-WFGJKAKNSA-N.
| Molecular formula | C3H8N2S |
|---|---|
| Molecular weight | 110.21 g/mol |
| IUPAC name | 1,3-bis(trideuteriomethyl)thiourea |
| InChIKey | VLCDUOXHFNUCKK-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])NC(=S)NC([2H])([2H])[2H] |
Computed by PubChem (NCBI)