CAS 132949-41-8 is the registry number for 4-Bromo-2,6-dimethylbenzamide, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
4-bromo-2,6-dimethylbenzamide (CAS 132949-41-8) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 4-bromo-2,6-dimethylbenzamide. InChIKey: XVYIGNNYCQHLJI-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 4-bromo-2,6-dimethylbenzamide |
| InChIKey | XVYIGNNYCQHLJI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)N)C)Br |
Computed by PubChem (NCBI)