Products 13295-40-4
CAS 13295-40-4 appears in our catalog under these names: rel-(1S,2S,4S)-N-Methylbicyclo[2.2.1]hept-5-ene-2-carboxamide, 98%, ENDO-N-METHYL-5-NORBORNENE-2-CARBOXAMID&. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 100MG.
(1S,2S,4S)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide (CAS 13295-40-4) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. IUPAC name: (1S,2S,4S)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide. InChIKey: QDIURVLTYFGLCN-RNJXMRFFSA-N.
| Molecular formula | C9H13NO |
|---|---|
| Molecular weight | 151.21 g/mol |
| IUPAC name | (1S,2S,4S)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| InChIKey | QDIURVLTYFGLCN-RNJXMRFFSA-N |
| SMILES | CNC(=O)[C@H]1C[C@@H]2C[C@H]1C=C2 |
Computed by PubChem (NCBI)