CAS 1329502-88-6 is the registry number for N-(4-Hydroxyphenyl)piperazine-d8, Dihydrobromide. Offered by: TRC. Available pack sizes: 50mg, 5mg.
4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)phenol;dihydrobromide (CAS 1329502-88-6) is a chemical compound with the molecular formula C10H16Br2N2O and a molecular weight of 348.10 g/mol. IUPAC name: 4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)phenol;dihydrobromide. InChIKey: IRGIAGAHMWSRKP-WSFKPVRBSA-N.
| Molecular formula | C10H16Br2N2O |
|---|---|
| Molecular weight | 348.10 g/mol |
| IUPAC name | 4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)phenol;dihydrobromide |
| InChIKey | IRGIAGAHMWSRKP-WSFKPVRBSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=CC=C(C=C2)O)([2H])[2H])[2H].Br.Br |
Computed by PubChem (NCBI)