CAS 1329509-46-7 is the registry number for 4,6-Dimethyl-2(1H)-pyrimidinone-13C,15N2 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
4,6-dimethyl-(213C,1,3-15N2)1H-pyrimidin-2-one;hydrochloride (CAS 1329509-46-7) is a chemical compound with the molecular formula C6H9ClN2O and a molecular weight of 163.58 g/mol. IUPAC name: 4,6-dimethyl-(213C,1,3-15N2)1H-pyrimidin-2-one;hydrochloride. InChIKey: IFXXETYYSLJRNF-JXAPDFANSA-N.
| Molecular formula | C6H9ClN2O |
|---|---|
| Molecular weight | 163.58 g/mol |
| IUPAC name | 4,6-dimethyl-(213C,1,3-15N2)1H-pyrimidin-2-one;hydrochloride |
| InChIKey | IFXXETYYSLJRNF-JXAPDFANSA-N |
| SMILES | CC1=CC(=[15N][13C](=O)[15NH]1)C.Cl |
Computed by PubChem (NCBI)