CAS 1329509-68-3 is the registry number for Pentylenetetrazole-d6, >95% (GC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
6,6,7,7,8,8-hexadeuterio-5,9-dihydrotetrazolo[1,5-a]azepine (CAS 1329509-68-3) is a chemical compound with the molecular formula C6H10N4 and a molecular weight of 144.21 g/mol. IUPAC name: 6,6,7,7,8,8-hexadeuterio-5,9-dihydrotetrazolo[1,5-a]azepine. InChIKey: CWRVKFFCRWGWCS-NMFSSPJFSA-N.
| Molecular formula | C6H10N4 |
|---|---|
| Molecular weight | 144.21 g/mol |
| IUPAC name | 6,6,7,7,8,8-hexadeuterio-5,9-dihydrotetrazolo[1,5-a]azepine |
| InChIKey | CWRVKFFCRWGWCS-NMFSSPJFSA-N |
| SMILES | [2H]C1(CC2=NN=NN2CC(C1([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)