CAS 1329509-71-8 is the registry number for Propiverine N–oxide (hydrochloride). Offered by: GLPBio. Available pack sizes: 500μg, 1mg, 5mg.
(1-methyl-1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate;hydrochloride (CAS 1329509-71-8) is a chemical compound with the molecular formula C23H30ClNO4 and a molecular weight of 419.9 g/mol. IUPAC name: (1-methyl-1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate;hydrochloride. InChIKey: AQIMDNRULRIUOM-UHFFFAOYSA-N.
| Molecular formula | C23H30ClNO4 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | (1-methyl-1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate;hydrochloride |
| InChIKey | AQIMDNRULRIUOM-UHFFFAOYSA-N |
| SMILES | CCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OC3CC[N+](CC3)(C)[O-].Cl |
Computed by PubChem (NCBI)