CAS 1329556-69-5 appears in our catalog under these names: Eniluracil-13C-15N2, Eniluracil-13C,15N2. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
5-ethynyl-(213C,1,3-15N2)1H-pyrimidine-2,4-dione (CAS 1329556-69-5) is a chemical compound with the molecular formula C6H4N2O2 and a molecular weight of 139.09 g/mol. IUPAC name: 5-ethynyl-(213C,1,3-15N2)1H-pyrimidine-2,4-dione. InChIKey: JOZGNYDSEBIJDH-TTXLGWKISA-N.
| Molecular formula | C6H4N2O2 |
|---|---|
| Molecular weight | 139.09 g/mol |
| IUPAC name | 5-ethynyl-(213C,1,3-15N2)1H-pyrimidine-2,4-dione |
| InChIKey | JOZGNYDSEBIJDH-TTXLGWKISA-N |
| SMILES | C#CC1=C[15NH][13C](=O)[15NH]C1=O |
Computed by PubChem (NCBI)