Products 1329610-39-0
CAS 1329610-39-0 appears in our catalog under these names: Lisdexamphetamine-d3 Dihydrochloride (1mg/ml in Acetonitrile), Lisdexamphetamine-d3 Dihydrochloride, >95% (HPLC), Lisdexamphetamine-d3 dihydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 1x1ml, 10mg, 1mg, 5mg, 25mg, 50mg.
(2S)-2,6-diamino-N-[(2S)-1,1,1-trideuterio-3-phenylpropan-2-yl]hexanamide (CAS 1329610-39-0) is a chemical compound with the molecular formula C15H25N3O and a molecular weight of 266.40 g/mol. IUPAC name: (2S)-2,6-diamino-N-[(2S)-1,1,1-trideuterio-3-phenylpropan-2-yl]hexanamide. InChIKey: VOBHXZCDAVEXEY-BOYPKXIPSA-N.
| Molecular formula | C15H25N3O |
|---|---|
| Molecular weight | 266.40 g/mol |
| IUPAC name | (2S)-2,6-diamino-N-[(2S)-1,1,1-trideuterio-3-phenylpropan-2-yl]hexanamide |
| InChIKey | VOBHXZCDAVEXEY-BOYPKXIPSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](CC1=CC=CC=C1)NC(=O)[C@H](CCCCN)N |
Computed by PubChem (NCBI)