CAS 1329610-58-3 is the registry number for (S)-2-Methyl-1-(4-toluenesulfonyloxy)hexane-d3. Offered by: TRC. Available pack sizes: 100mg, 1g.
[(2S)-2-(trideuteriomethyl)hexyl] 4-methylbenzenesulfonate (CAS 1329610-58-3) is a chemical compound with the molecular formula C14H22O3S and a molecular weight of 273.41 g/mol. IUPAC name: [(2S)-2-(trideuteriomethyl)hexyl] 4-methylbenzenesulfonate. InChIKey: AOWAQOSWMSVFSV-LPCKOZKESA-N.
| Molecular formula | C14H22O3S |
|---|---|
| Molecular weight | 273.41 g/mol |
| IUPAC name | [(2S)-2-(trideuteriomethyl)hexyl] 4-methylbenzenesulfonate |
| InChIKey | AOWAQOSWMSVFSV-LPCKOZKESA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](CCCC)COS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)