Products 1329614-76-7
CAS 1329614-76-7 is the registry number for (S)-2-Methylhexanol-d3. Offered by: TRC. Available pack sizes: 100mg, 1g.
(2S)-2-(trideuteriomethyl)hexan-1-ol (CAS 1329614-76-7) is a chemical compound with the molecular formula C7H16O and a molecular weight of 119.22 g/mol. IUPAC name: (2S)-2-(trideuteriomethyl)hexan-1-ol. InChIKey: LCFKURIJYIJNRU-HMQROFFESA-N.
| Molecular formula | C7H16O |
|---|---|
| Molecular weight | 119.22 g/mol |
| IUPAC name | (2S)-2-(trideuteriomethyl)hexan-1-ol |
| InChIKey | LCFKURIJYIJNRU-HMQROFFESA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](CCCC)CO |
Computed by PubChem (NCBI)