CAS 1329616-28-5 is the registry number for (2R,4R)-rel-2,4-Bis(2’,4’-difluorophenyl)-2,4-dihydroxypentane. Offered by: TRC. Available pack sizes: 500mg, 50mg.
(2R,4R)-2,4-bis(2,4-difluorophenyl)pentane-2,4-diol (CAS 1329616-28-5) is a chemical compound with the molecular formula C17H16F4O2 and a molecular weight of 328.30 g/mol. IUPAC name: (2R,4R)-2,4-bis(2,4-difluorophenyl)pentane-2,4-diol. InChIKey: BUIQPLVQIGSHGP-IAGOWNOFSA-N.
| Molecular formula | C17H16F4O2 |
|---|---|
| Molecular weight | 328.30 g/mol |
| IUPAC name | (2R,4R)-2,4-bis(2,4-difluorophenyl)pentane-2,4-diol |
| InChIKey | BUIQPLVQIGSHGP-IAGOWNOFSA-N |
| SMILES | C[C@@](C[C@](C)(C1=C(C=C(C=C1)F)F)O)(C2=C(C=C(C=C2)F)F)O |
Computed by PubChem (NCBI)