Products 1329643-24-4
CAS 1329643-24-4 appears in our catalog under these names: Omega-Hydroxy Fentanyl-d5, omega-Hydroxy Fentanyl-d5 (1.0mg/ml in Acetonitrile). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
3-hydroxy-N-(2,3,4,5,6-pentadeuteriophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide (CAS 1329643-24-4) is a chemical compound with the molecular formula C22H28N2O2 and a molecular weight of 357.5 g/mol. IUPAC name: 3-hydroxy-N-(2,3,4,5,6-pentadeuteriophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide. InChIKey: BXGSQUNMZMHPKS-OUHXUHDZSA-N.
| Molecular formula | C22H28N2O2 |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | 3-hydroxy-N-(2,3,4,5,6-pentadeuteriophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| InChIKey | BXGSQUNMZMHPKS-OUHXUHDZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N(C2CCN(CC2)CCC3=CC=CC=C3)C(=O)CCO)[2H])[2H] |
Computed by PubChem (NCBI)