CAS 132969-10-9 appears in our catalog under these names: 2-(Chloromethyl)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyridine, 95%, 2–(chloromethyl)–4–(2,2,3,3,4,4,4–heptafluorobutoxy)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-(chloromethyl)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyridine (CAS 132969-10-9) is a chemical compound with the molecular formula C10H7ClF7NO and a molecular weight of 325.61 g/mol. IUPAC name: 2-(chloromethyl)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyridine. InChIKey: HBOZIXCLLBNILB-UHFFFAOYSA-N.
| Molecular formula | C10H7ClF7NO |
|---|---|
| Molecular weight | 325.61 g/mol |
| IUPAC name | 2-(chloromethyl)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyridine |
| InChIKey | HBOZIXCLLBNILB-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1OCC(C(C(F)(F)F)(F)F)(F)F)CCl |
Computed by PubChem (NCBI)