CAS 1329698-96-5 appears in our catalog under these names: Sodium 5-phenyl-1,3-oxazole-2-carboxylate, Sodium 5-phenyl-1,3-oxazole-2-carboxylate, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
Sodium 5-phenyl-1,3-oxazole-2-carboxylate (CAS 1329698-96-5) is a chemical compound with the molecular formula C10H6NNaO3 and a molecular weight of 211.15 g/mol. IUPAC name: sodium 5-phenyl-1,3-oxazole-2-carboxylate. InChIKey: DJBVNWMORVQGEI-UHFFFAOYSA-M.
| Molecular formula | C10H6NNaO3 |
|---|---|
| Molecular weight | 211.15 g/mol |
| IUPAC name | sodium 5-phenyl-1,3-oxazole-2-carboxylate |
| InChIKey | DJBVNWMORVQGEI-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)