CAS 132974-83-5 is the registry number for (S)-5-(((tert-Butyldiphenylsilyl)oxy)methyl)pyrrolidin-2-one, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one (CAS 132974-83-5) is a chemical compound with the molecular formula C21H27NO2Si and a molecular weight of 353.5 g/mol. IUPAC name: (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one. InChIKey: GVPMKPSKHXFYOR-KRWDZBQOSA-N.
| Molecular formula | C21H27NO2Si |
|---|---|
| Molecular weight | 353.5 g/mol |
| IUPAC name | (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one |
| InChIKey | GVPMKPSKHXFYOR-KRWDZBQOSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC[C@@H]3CCC(=O)N3 |
Computed by PubChem (NCBI)