CAS 1329745-98-3 appears in our catalog under these names: Citalopram Impurity 9(Citalopram EP Impurity G), Escitalopram EP Impurity G,Citalopram EP Impurity G, Citalopram Impurity 1(5-Dimethylaminobutyryl citalopram), Citalopram Dimethylaminobutanone, 5-Dimethylaminobutyryl citalopram. Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2mg, 1mg.
4-(dimethylamino)-1-[1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]butan-1-one (CAS 1329745-98-3) is a chemical compound with the molecular formula C25H33FN2O2 and a molecular weight of 412.5 g/mol. IUPAC name: 4-(dimethylamino)-1-[1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]butan-1-one. InChIKey: AQRPROCETRZTEF-UHFFFAOYSA-N.
| Molecular formula | C25H33FN2O2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 4-(dimethylamino)-1-[1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]butan-1-one |
| InChIKey | AQRPROCETRZTEF-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC(=O)C1=CC2=C(C=C1)C(OC2)(CCCN(C)C)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)