Products 132975-07-6

CAS 132975-07-6 is the registry number for S-(2-Mercaptoethyl) benzothioate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

S-(2-sulfanylethyl) benzenecarbothioate (CAS 132975-07-6) is a chemical compound with the molecular formula C9H10OS2 and a molecular weight of 198.3 g/mol. IUPAC name: S-(2-sulfanylethyl) benzenecarbothioate. InChIKey: QZJLJABLDNRKOD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10OS2
Molecular weight198.3 g/mol
IUPAC nameS-(2-sulfanylethyl) benzenecarbothioate
InChIKeyQZJLJABLDNRKOD-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)SCCS

Computed by PubChem (NCBI)