Products 1329796-98-6
CAS 1329796-98-6 is the registry number for D,L-Mevalonic Acid-d3 Dicyclohexylamine Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
N-cyclohexylcyclohexanamine;3,5-dihydroxy-3-(trideuteriomethyl)pentanoic acid (CAS 1329796-98-6) is a chemical compound with the molecular formula C18H35NO4 and a molecular weight of 332.5 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;3,5-dihydroxy-3-(trideuteriomethyl)pentanoic acid. InChIKey: DCKUKHIZWLYMEF-SVLQTQOOSA-N.
| Molecular formula | C18H35NO4 |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;3,5-dihydroxy-3-(trideuteriomethyl)pentanoic acid |
| InChIKey | DCKUKHIZWLYMEF-SVLQTQOOSA-N |
| SMILES | [2H]C([2H])([2H])C(CCO)(CC(=O)O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)