CAS 1329799-64-5 appears in our catalog under these names: Piracetam-d8, Piracetam-d8, 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,01g.
2,2-dideuterio-2-(2,2,3,3,4,4-hexadeuterio-5-oxopyrrolidin-1-yl)acetamide (CAS 1329799-64-5) is a chemical compound with the molecular formula C6H10N2O2 and a molecular weight of 150.20 g/mol. IUPAC name: 2,2-dideuterio-2-(2,2,3,3,4,4-hexadeuterio-5-oxopyrrolidin-1-yl)acetamide. InChIKey: GMZVRMREEHBGGF-SVYQBANQSA-N.
| Molecular formula | C6H10N2O2 |
|---|---|
| Molecular weight | 150.20 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,2,3,3,4,4-hexadeuterio-5-oxopyrrolidin-1-yl)acetamide |
| InChIKey | GMZVRMREEHBGGF-SVYQBANQSA-N |
| SMILES | [2H]C1(C(=O)N(C(C1([2H])[2H])([2H])[2H])C([2H])([2H])C(=O)N)[2H] |
Computed by PubChem (NCBI)