CAS 1329799-77-0 is the registry number for 9N-Trityl Guanine-13C2,15N. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
2-amino-9-trityl-1H-purin-6-one (CAS 1329799-77-0) is a chemical compound with the molecular formula C24H19N5O and a molecular weight of 396.4 g/mol. IUPAC name: 2-amino-9-trityl-1H-purin-6-one. InChIKey: JPRZNDHSBUBJNH-DROVMUMNSA-N.
| Molecular formula | C24H19N5O |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 2-amino-9-trityl-1H-purin-6-one |
| InChIKey | JPRZNDHSBUBJNH-DROVMUMNSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=[15N][13C]5=[13C]4N=C(NC5=O)N |
Computed by PubChem (NCBI)