CAS 1329805-71-1 appears in our catalog under these names: Pethoxamid Sulfonic Acid Sodium, Pethoxamid ESA sodium salt, Concentration: 100 µg/ml Solvent: Acetonitrile, Pethoxamid ESA sodium salt. Offered by: TRC, HPC Standards. Available pack sizes: 50mg, 1x1ml, 1x10mg.
Sodium 2-[2-ethoxyethyl-(2-methyl-1-phenylprop-1-enyl)amino]-2-oxoethanesulfonate (CAS 1329805-71-1) is a chemical compound with the molecular formula C16H22NNaO5S and a molecular weight of 363.4 g/mol. IUPAC name: sodium 2-[2-ethoxyethyl-(2-methyl-1-phenylprop-1-enyl)amino]-2-oxoethanesulfonate. InChIKey: UYJGQZNXCHUADH-UHFFFAOYSA-M.
| Molecular formula | C16H22NNaO5S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | sodium 2-[2-ethoxyethyl-(2-methyl-1-phenylprop-1-enyl)amino]-2-oxoethanesulfonate |
| InChIKey | UYJGQZNXCHUADH-UHFFFAOYSA-M |
| SMILES | CCOCCN(C(=O)CS(=O)(=O)[O-])C(=C(C)C)C1=CC=CC=C1.[Na+] |
Computed by PubChem (NCBI)