CAS 1329809-18-8 is the registry number for Barbituric Acid-13C,15N2. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(213C,1,3-15N2)1,3-diazinane-2,4,6-trione (CAS 1329809-18-8) is a chemical compound with the molecular formula C4H4N2O3 and a molecular weight of 131.07 g/mol. IUPAC name: (213C,1,3-15N2)1,3-diazinane-2,4,6-trione. InChIKey: HNYOPLTXPVRDBG-VMGGCIAMSA-N.
| Molecular formula | C4H4N2O3 |
|---|---|
| Molecular weight | 131.07 g/mol |
| IUPAC name | (213C,1,3-15N2)1,3-diazinane-2,4,6-trione |
| InChIKey | HNYOPLTXPVRDBG-VMGGCIAMSA-N |
| SMILES | C1C(=O)[15NH][13C](=O)[15NH]C1=O |
Computed by PubChem (NCBI)