CAS 1329812-14-7 is the registry number for Bis(2-chloroethyl)methylamine-d4 hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 25mg.
2-chloro-N-(2-chloro-2,2-dideuterioethyl)-2,2-dideuterio-N-methylethanamine;hydrochloride (CAS 1329812-14-7) is a chemical compound with the molecular formula C5H12Cl3N and a molecular weight of 196.53 g/mol. IUPAC name: 2-chloro-N-(2-chloro-2,2-dideuterioethyl)-2,2-dideuterio-N-methylethanamine;hydrochloride. InChIKey: QZIQJVCYUQZDIR-DAHDXRBSSA-N.
| Molecular formula | C5H12Cl3N |
|---|---|
| Molecular weight | 196.53 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro-2,2-dideuterioethyl)-2,2-dideuterio-N-methylethanamine;hydrochloride |
| InChIKey | QZIQJVCYUQZDIR-DAHDXRBSSA-N |
| SMILES | [2H]C([2H])(CN(C)CC([2H])([2H])Cl)Cl.Cl |
Computed by PubChem (NCBI)