Products 1329834-25-4
CAS 1329834-25-4 appears in our catalog under these names: N-Nitroso Nipecotic Acid-d4 (Major), >95% (HPLC), N-Nitroso nipecotic acid-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2,2,6,6-tetradeuterio-1-nitrosopiperidine-3-carboxylic acid (CAS 1329834-25-4) is a chemical compound with the molecular formula C6H10N2O3 and a molecular weight of 162.18 g/mol. IUPAC name: 2,2,6,6-tetradeuterio-1-nitrosopiperidine-3-carboxylic acid. InChIKey: YGOAQYQGTQBALO-KHORGVISSA-N.
| Molecular formula | C6H10N2O3 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterio-1-nitrosopiperidine-3-carboxylic acid |
| InChIKey | YGOAQYQGTQBALO-KHORGVISSA-N |
| SMILES | [2H]C1(CCC(C(N1N=O)([2H])[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)