CAS 1329834-28-7 appears in our catalog under these names: Ibandronic Acid-d3 Sodium Salt, >95% (HPLC), Ibandronic Acid-d3 (sodium salt). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
Sodium hydroxy-[1-hydroxy-3-[pentyl(trideuteriomethyl)amino]-1-phosphonopropyl]phosphinate (CAS 1329834-28-7) is a chemical compound with the molecular formula C9H22NNaO7P2 and a molecular weight of 344.23 g/mol. IUPAC name: sodium hydroxy-[1-hydroxy-3-[pentyl(trideuteriomethyl)amino]-1-phosphonopropyl]phosphinate. InChIKey: LXLBEOAZMZAZND-MUTAZJQDSA-M.
| Molecular formula | C9H22NNaO7P2 |
|---|---|
| Molecular weight | 344.23 g/mol |
| IUPAC name | sodium hydroxy-[1-hydroxy-3-[pentyl(trideuteriomethyl)amino]-1-phosphonopropyl]phosphinate |
| InChIKey | LXLBEOAZMZAZND-MUTAZJQDSA-M |
| SMILES | [2H]C([2H])([2H])N(CCCCC)CCC(O)(P(=O)(O)O)P(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)